CAS 175553-48-7
:(2S)-[1-[(2S)-2-AMINO-1-OXOBUTYL]-N-BUTYL]-2,3-DIHYDRO-1H-INDOLE-2-CARBOXAMIDE OXALATE
Description:
The chemical substance known as (2S)-[1-[(2S)-2-amino-1-oxobutyl]-N-butyl]-2,3-dihydro-1H-indole-2-carboxamide oxalate, with the CAS number 175553-48-7, is a synthetic compound that belongs to the class of indole derivatives. It features a complex structure characterized by an indole ring fused with a dihydro moiety, which contributes to its potential biological activity. The presence of an amino acid derivative and a butyl group suggests that it may interact with biological systems, possibly influencing receptor activity or enzyme function. The oxalate salt form indicates that it is likely used for improved solubility and stability in pharmaceutical formulations. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutics targeting various diseases. Its specific characteristics, such as solubility, melting point, and biological activity, would typically be determined through experimental studies and may vary based on the formulation and conditions used.
Formula:C19H27N3O6
InChI:InChI=1/C17H25N3O2.C2H2O4/c1-3-5-10-19-16(21)15-11-12-8-6-7-9-14(12)20(15)17(22)13(18)4-2;3-1(4)2(5)6/h6-9,13,15H,3-5,10-11,18H2,1-2H3,(H,19,21);(H,3,4)(H,5,6)/t13?,15-;/m0./s1
SMILES:CCCCN=C([C@@H]1Cc2ccccc2N1C(=O)C(CC)N)O.C(=O)(C(=O)O)O
Synonyms:- Butabindide Oxalate
- (2S)-1-(2-aminobutanoyl)-N-butyl-indoline-2-carboxamide
- Oxalic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butabindide
CAS:<p>Butabindide (UCL-1397) selectively inhibits TPP II, protecting CCK-8, with Ki of 10 μM (TPP I) and 7 nM (TPP II).</p>Formula:C17H25N3O2Color and Shape:SolidMolecular weight:303.4
