
CAS 17558-97-3
:1,6-Hexanediamine, phosphate (1:?)
Description:
1,6-Hexanediamine, phosphate (1:?) is an organic compound characterized by its amine functional groups and phosphate moiety. It is derived from 1,6-hexanediamine, a straight-chain aliphatic diamine, which contributes to its properties as a building block in various chemical applications. The phosphate group enhances its solubility in water and can influence its reactivity, making it useful in formulations such as fertilizers, surfactants, and corrosion inhibitors. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its ability to form complexes with metal ions, which can be advantageous in catalysis and materials science. Safety considerations include handling it with care, as amines can be irritating to the skin and respiratory system. Overall, 1,6-hexanediamine phosphate is valued in both industrial and research settings for its versatile chemical properties and potential applications.
Formula:C6H16N2·xH3O4P
InChI:InChI=1S/C6H16N2.H3O4P/c7-5-3-1-2-4-6-8;1-5(2,3)4/h1-8H2;(H3,1,2,3,4)
InChI key:InChIKey=COVSKPKHYJXXHY-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)O.C(CCCN)CCN
Synonyms:- Hexamethylenediammonium phosphate
- 1,6-Hexanediamine, phosphate
- 1,6-Hexanediamine, phosphate (1:?)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
