CAS 175592-59-3
:2-Formylthiophene-4-boronic acid
Description:
2-Formylthiophene-4-boronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and a thiophene ring with an aldehyde substituent. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid group, which can form hydrogen bonds. The thiophene ring contributes to its aromatic properties, enhancing stability and reactivity in various chemical reactions, particularly in cross-coupling reactions, which are significant in organic synthesis and materials science. The boronic acid moiety allows for the formation of boronate esters, making it useful in Suzuki-Miyaura coupling reactions. Additionally, the aldehyde functional group can participate in further transformations, such as condensation reactions. Overall, 2-Formylthiophene-4-boronic acid is a versatile building block in organic chemistry, particularly in the synthesis of complex organic molecules and polymers.
Formula:C5H5BO3S
InChI:InChI=1/C5H5BO3S/c7-2-5-1-4(3-10-5)6(8)9/h1-3,8-9H
SMILES:c1c(csc1C=O)B(O)O
Synonyms:- Rarechem Ah Pb 0175
- Akos Brn-0508
- 5-Formylthiophene-3-Boronic Acid
- 5-Formylthiophen-3-Boronic Acid
- 2-Formyl-Thienyl-4-Boronic Acid
- 2-Formyl-4-Thiopheneboronic Acid
- Boronic acid, (5-formyl-3-thienyl)- (9CI)
- (5-Formylthiophen-3-Yl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Boronic acid, B-(5-formyl-3-thienyl)-
CAS:Formula:C5H5BO3SPurity:97%Color and Shape:SolidMolecular weight:155.96745-Formylthiophene-3-boronic acid
CAS:5-Formylthiophene-3-boronic acidFormula:C5H5BO3SPurity:97%Color and Shape: beige solidMolecular weight:155.97g/mol(5-Formylthiophen-3-yl)boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H5BO3SColor and Shape:White to Gray to Red powder to crystalMolecular weight:155.962-Formylthiophene-4-boronic acid
CAS:Formula:C5H5BO3SPurity:95%Color and Shape:SolidMolecular weight:155.962-Formylthiophene-4-boronic acid
CAS:2-Formylthiophene-4-boronic acid is an inhibitor of the protein kinase family. The IC50 values for 2-Formylthiophene-4-boronic acid are 0.078 µM, 0.056 µM, and 0.038 µM against cdc2, cdc13, and cdk1 respectively.Formula:C5H5BO3SPurity:Min. 95%Molecular weight:155.97 g/mol




