CAS 1756-18-9
:2,3-Dihydroxy-3-methylbutanoic acid
Description:
2,3-Dihydroxy-3-methylbutanoic acid, with the CAS number 1756-18-9, is an organic compound characterized by its structure, which features two hydroxyl (-OH) groups and a carboxylic acid (-COOH) functional group. This compound is a type of hydroxy acid, specifically a derivative of butanoic acid, and is known for its chiral center, leading to potential stereoisomerism. It is typically a colorless to pale yellow solid or liquid, depending on its state at room temperature. The presence of hydroxyl groups contributes to its solubility in water and its ability to participate in hydrogen bonding, which can influence its reactivity and interactions with other molecules. 2,3-Dihydroxy-3-methylbutanoic acid may be involved in various biochemical pathways and can serve as an intermediate in the synthesis of other compounds. Its applications can extend to fields such as pharmaceuticals, biochemistry, and food science, where it may play a role in metabolic processes or as a flavoring agent.
Formula:C5H10O4
InChI:InChI=1S/C5H10O4/c1-5(2,9)3(6)4(7)8/h3,6,9H,1-2H3,(H,7,8)
InChI key:InChIKey=JTEYKUFKXGDTEU-UHFFFAOYSA-N
SMILES:C(C(C)(C)O)(C(O)=O)O
Synonyms:- (±)-α,β-Dihydroxyisovaleric acid
- 2,3-Dihydroxy-3-Methylbutanoic Acid
- 2,3-Dihydroxy-3-methylbutanoate
- 2,3-Dihydroxyisovaleric acid
- 3-Methyl-2,3-dihydroxybutyric acid
- Butanoic acid, 2,3-dihydroxy-3-methyl-
- Butyric acid, 2,3-dihydroxy-3-methyl-
- Nsc 181496
- α,β-Dihydroxyisovalerate
- alpha,beta-Dihydroxyisovaleric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Butanoic acid, 2,3-dihydroxy-3-methyl-
CAS:Formula:C5H10O4Purity:95%Color and Shape:SolidMolecular weight:134.13052,3-dihydroxy-3-methylbutanoic acid
CAS:2,3-dihydroxy-3-methylbutanoic acidPurity:≥95%Molecular weight:134.1305g/mol2,3-dihydroxy-3-methylbutanoic acid
CAS:2,3-dihydroxy-3-methylbutanoic acid, a leucine metabolite, boosts muscle growth by activating mTOR.Formula:C5H10O4Purity:99.03%Color and Shape:SolidMolecular weight:134.1305Ref: TM-T50050
1mg57.00€2mg86.00€5mg119.00€10mg172.00€25mg295.00€50mg442.00€100mg645.00€500mg1,333.00€1mL*10mM (DMSO)90.00€2,3-dihydroxy-3-methylbutanoic acid
CAS:Controlled ProductStability Moisture Sensitive
Applications 2,3-dihydroxy-3-methylbutanoic acid (cas# 1756-18-9) is a useful research chemical.Formula:C5H10O4Color and Shape:NeatMolecular weight:134.132,3-Dihydroxy-3-methylbutanoic acid
CAS:2,3-Dihydroxy-3-methylbutanoic acid (2,3DMB) is a hydrophobic molecule that is used as an activator of the butyric acid pathway. This activation mechanism has been shown in vitro with the use of 2,3DMB and racemase to convert isovaleric acid into butyric acid. The activation mechanism can be seen in vivo by synthesizing 2,3DMB from its constituent parts: magnesium ion and a monocarboxylic acid. The reaction occurs when magnesium ion binds to the carboxyl group of a monocarboxylic acid in the presence of water. In this reaction, water acts as a base to remove hydrogen ions from the carboxyl group and release protons. The protonated carboxyl group then reacts with magnesium ion to form an intermediate compound called Grignard reagent. The Grignard reagent will react with water to form anFormula:C5H10O4Purity:Min. 95%Color and Shape:PowderMolecular weight:134.13 g/mol




