CAS 17561-26-1
:(S)-(-)-2-Chloro-3-[4(5)-imidazolyl]propionic Acid
Description:
(S)-(-)-2-Chloro-3-[4(5)-imidazolyl]propionic acid, with CAS number 17561-26-1, is a chiral compound characterized by its specific stereochemistry, indicated by the (S)- designation. This compound features a propionic acid backbone with a chlorine atom at the second carbon and an imidazole ring substituent at the third carbon. The presence of the imidazole group suggests potential biological activity, as imidazole derivatives are often found in pharmaceuticals and biologically active compounds. The compound is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. Its chirality may influence its interaction with biological systems, making it relevant in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns due to the presence of both the chlorine atom and the carboxylic acid functional group, which can participate in various chemical reactions, including nucleophilic substitutions and esterifications. Overall, this compound's unique structure and properties make it of interest in both synthetic and medicinal chemistry contexts.
Formula:C6H7ClN2O2
InChI:InChI=1/C6H7ClN2O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1H2,(H,8,9)(H,10,11)/t5-/m0/s1
SMILES:C(c1cnc[nH]1)[C@@H](C(=O)O)Cl
Synonyms:- (S)-a-Chloro-1H-imidazole-4-propanoic Acid
- Nsc 30490
- ((S)-Chloro-1H-imidazole-4-propanoic Acid
- Nsc 304903)
- 2-chloro-3-(1H-imidazol-5-yl)propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-2-Chloro-3-(1H-imidazol-4-yl)propanoic acid
CAS:Formula:C6H7ClN2O2Color and Shape:SolidMolecular weight:174.5850(S)-(-)-2-Chloro-3-[4(5)-imidazolyl]propionic Acid
CAS:Controlled ProductFormula:C6H7ClN2O2Color and Shape:NeatMolecular weight:174.58(S)-(-)-2-Chloro-3-[4(5)-imidazolyl]propionic acid
CAS:(S)-(-)-2-Chloro-3-[4(5)-imidazolyl]propionic acid is a high quality reagent that is used as an intermediate in the synthesis of complex compounds. It has been used as a building block for the synthesis of different types of compounds with speciality chemicals, such as research chemicals and reaction components. This compound is also versatile and can be used to synthesize both small and large molecules. The CAS number for this chemical is 17561-26-1.Formula:C6H7ClN2O2Purity:Min. 95%Color and Shape:White To Beige SolidMolecular weight:174.58 g/mol


