CAS 17566-51-7
:N,N-dimethylcyclohexanecarboxamide
Description:
N,N-Dimethylcyclohexanecarboxamide is an organic compound characterized by its amide functional group, which is derived from cyclohexanecarboxylic acid. It features a cyclohexane ring substituted with two methyl groups on the nitrogen atom of the amide, contributing to its unique properties. This compound is typically a colorless to pale yellow liquid with a relatively high boiling point, indicative of strong intermolecular forces due to hydrogen bonding. It is soluble in organic solvents and exhibits low solubility in water, reflecting its hydrophobic nature. N,N-Dimethylcyclohexanecarboxamide is often used in various applications, including as a solvent, in chemical synthesis, and as an intermediate in the production of pharmaceuticals and agrochemicals. Its chemical stability and moderate toxicity make it suitable for industrial use, although proper handling and safety measures are essential due to potential health risks associated with exposure. Overall, this compound exemplifies the characteristics of amides, including their polar nature and ability to participate in hydrogen bonding.
Formula:C9H17NO
InChI:InChI=1/C9H17NO/c1-10(2)9(11)8-6-4-3-5-7-8/h8H,3-7H2,1-2H3
SMILES:CN(C)C(=O)C1CCCCC1
Synonyms:- cyclohexanecarboxamide, N,N-dimethyl-
- N,N-Dimethylcyclohexanecarboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N,N-Dimethylcyclohexanecarboxamide
CAS:<p>N,N-Dimethylcyclohexanecarboxamide is an acid salt of besylate that is used as a drug for the treatment of hyperglycemia. It has been shown to have a rapid onset and short duration of action. The chemical name for N,N-Dimethylcyclohexanecarboxamide is 1-[2-(2-methoxyethoxy)ethyl]-4-methyl-1,4-dihydropyridine 2,4-dicarboxylic acid methyl ester. This compound inhibits insulin release from the pancreas and stimulates glucagon release from the alpha cells in the pancreas. These effects lead to an increase in blood glucose levels.</p>Formula:C9H17NOPurity:Min. 95%Molecular weight:155.24 g/mol
