CAS 175671-43-9
:(2S,4R)-methyl 4-hydroxypiperidine-2-carboxylate hydrochloride
Description:
(2S,4R)-methyl 4-hydroxypiperidine-2-carboxylate hydrochloride is a chemical compound characterized by its piperidine ring structure, which features a hydroxyl group and a carboxylate moiety. This compound is a chiral molecule, with specific stereochemistry indicated by the (2S,4R) configuration, which plays a crucial role in its biological activity and interactions. The presence of the methyl ester group contributes to its solubility and reactivity, making it suitable for various applications in medicinal chemistry. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or other bioactive molecules. Its specific interactions and efficacy would depend on its molecular structure, making it of interest in drug development and research. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C7H14ClNO3
InChI:InChI=1/C7H13NO3.ClH/c1-11-7(10)6-4-5(9)2-3-8-6;/h5-6,8-9H,2-4H2,1H3;1H/t5-,6+;/m1./s1
Synonyms:- 2-piperidinecarboxylic acid, 4-hydroxy-, methyl ester, (2S,4R)-, hydrochloride (1:1)
- methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate hydrochloride (1:1)
- methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2S,4R)-methyl 4-hydroxypiperidine-2-carboxylate hydrochloride
CAS:Formula:C7H14ClNO3Purity:95%Color and Shape:SolidMolecular weight:195.6440(2S,4R)-Methyl 4-hydroxypiperidine-2-carboxylate hydrochloride
CAS:(2S,4R)-Methyl 4-hydroxypiperidine-2-carboxylate hydrochlorideFormula:C7H13NO3·ClHPurity:98%Color and Shape: white crystalline powderMolecular weight:195.64g/mol(2S,4R)-Methyl 4-hydroxypiperidine-2-carboxylate hydrochloride
CAS:(2S,4R)-Methyl 4-hydroxypiperidine-2-carboxylate hydrochloride is a macrocyclization inhibitor that prevents the formation of macrocyclic compounds from simple building blocks. It is used in research to study the hepatitis C virus and HIV. The impurity profile of this compound is similar to that of (2S,4S)-methyl 4-hydroxypiperidine-2-carboxylate hydrochloride and includes ruthenium metal. This compound was isolated by a process that involved chromatography on silica and elution with chloroform/methanol. The isolation process resulted in high yields and outperformed a previous method of preparation.Formula:C7H13NO3ClHPurity:Min. 95%Molecular weight:195.64 g/mol


