CAS 175676-65-0
:2-(Trifluormethoxy)phenylboronic acid
Description:
2-(Trifluoromethoxy)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a trifluoromethoxy group. This compound typically exhibits properties such as high reactivity due to the boronic acid moiety, which can participate in various chemical reactions, including Suzuki coupling and other cross-coupling reactions. The trifluoromethoxy group enhances the compound's lipophilicity and can influence its electronic properties, making it a valuable building block in organic synthesis and medicinal chemistry. Additionally, the presence of fluorine atoms often imparts unique characteristics, such as increased stability and altered solubility in organic solvents. The compound is generally used in the development of pharmaceuticals and agrochemicals, as well as in materials science for creating functionalized polymers. Safety data should be consulted for handling and storage, as organoboron compounds can pose specific hazards.
Formula:C7H6BF3O3
InChI:InChI=1/C7H6BF3O3/c9-7(10,11)14-6-4-2-1-3-5(6)8(12)13/h1-4,12-13H
SMILES:c1ccc(c(c1)B(O)O)OC(F)(F)F
Synonyms:- 2-(Trifluoromethoxy)phenylboronicacid
- 2-(Trifluoromethoxy)phenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Boronic acid, B-[2-(trifluoromethoxy)phenyl]-
CAS:Formula:C7H6BF3O3Purity:98%Color and Shape:SolidMolecular weight:205.92692-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H6BF3O3Purity:97.0 to 110.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:205.932-(Trifluoromethoxy)benzeneboronic acid
CAS:2-(Trifluoromethoxy)benzeneboronic acidFormula:C7H6BF3O3Purity:≥95%Color and Shape: white to off-white crystalline solidMolecular weight:205.93g/mol2-(Trifluoromethoxy)benzeneboronic acid
CAS:Formula:C7H6BF3O3Purity:98%Color and Shape:Off-white powderMolecular weight:205.932-(Trifluoromethoxy)phenylboronic acid
CAS:2-(Trifluoromethoxy)phenylboronic acid (2-TFB) is a boronic acid that is used in cross-coupling reactions. It has been shown to be an effective inhibitor of the Vismodegib pathway, which may offer therapeutic benefits for cancer patients. 2-TFB has also been shown to inhibit the activity of other pathways involved in cancer development, such as the benzamide and suzuki pathways. 2-TFB is metabolized through filtration, which can lead to significant pharmacokinetic properties. This compound can be recycled and reused in cross-coupling reactions, which reduces waste production and costs.Formula:C7H6BF3O3Purity:Min. 95%Color and Shape:PowderMolecular weight:205.93 g/mol





