CAS 175691-03-9
:Hydrazine, [4-(2,2,3,3-tetrafluoropropoxy)phenyl]-
Description:
Hydrazine, [4-(2,2,3,3-tetrafluoropropoxy)phenyl]- is a chemical compound characterized by its hydrazine functional group and a phenyl ring substituted with a tetrafluoropropoxy group. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its reactivity, particularly as a reducing agent and in various chemical synthesis applications. The presence of the tetrafluoropropoxy group enhances its solubility in organic solvents and may influence its chemical stability and reactivity. Hydrazine derivatives are often utilized in the production of pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. However, it is important to note that hydrazine and its derivatives can be toxic and potentially hazardous, necessitating careful handling and appropriate safety measures during use. The compound's specific physical and chemical properties, such as boiling point, melting point, and density, would typically be determined through experimental methods or detailed literature references.
Formula:C9H10F4N2O
InChI:InChI=1S/C9H10F4N2O/c10-8(11)9(12,13)5-16-7-3-1-6(15-14)2-4-7/h1-4,8,15H,5,14H2
InChI key:InChIKey=INSOHUQFDWORAY-UHFFFAOYSA-N
SMILES:O(CC(C(F)F)(F)F)C1=CC=C(NN)C=C1
Synonyms:- [4-(2,2,3,3-Tetrafluoropropoxy)phenyl]hydrazine
- Hydrazine, [4-(2,2,3,3-tetrafluoropropoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
[4-(2,2,3,3-tetrafluoropropoxy)phenyl]hydrazine Hydrochloride
CAS:Controlled ProductFormula:C9H10F4N2O·HClColor and Shape:NeatMolecular weight:274.643
