CAS 175691-91-5
:[1,1′-Biphenyl]-3-carbothioamide
Description:
[1,1′-Biphenyl]-3-carbothioamide is an organic compound characterized by the presence of a biphenyl structure, which consists of two phenyl rings connected by a single bond, and a carbothioamide functional group. This compound features a sulfur atom bonded to a carbonyl group (C=S) and an amine (NH2) group, indicating its potential as a thiourea derivative. The presence of the carbothioamide group suggests that it may exhibit properties typical of thioureas, such as potential biological activity, including antimicrobial or antifungal properties. The compound's structure may influence its solubility, stability, and reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the biphenyl moiety can enhance the compound's lipophilicity, potentially affecting its interaction with biological membranes. Overall, [1,1′-Biphenyl]-3-carbothioamide represents a unique chemical entity with potential applications in medicinal chemistry and materials science.
Formula:C13H11NS
InChI:InChI=1S/C13H11NS/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,(H2,14,15)
InChI key:InChIKey=IDMWXOYPRCHOGP-UHFFFAOYSA-N
SMILES:C(N)(=S)C=1C=C(C=CC1)C2=CC=CC=C2
Synonyms:- 3-Phenylbenzene-1-carbothioamide
- [1,1′-Biphenyl]-3-carbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
