CymitQuimica logo

CAS 17570-30-8

:

2-Propenoicacid, 3-(4-aminophenyl)-, (2E)-

Description:
2-Propenoic acid, 3-(4-aminophenyl)-, (2E)-, also known as 4-aminophenyl acrylate, is an organic compound characterized by its acrylate structure, which features a vinyl group (C=C) and a carboxylic acid functional group (–COOH). This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state and purity. It is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound exhibits reactivity typical of acrylates, including the ability to undergo polymerization, making it useful in various applications such as adhesives, coatings, and as a monomer in polymer chemistry. The presence of the amino group (–NH2) on the phenyl ring enhances its potential for further chemical modifications and interactions, contributing to its utility in medicinal chemistry and materials science. Safety considerations include handling precautions due to potential irritant properties, and it is advisable to consult safety data sheets for specific handling guidelines.
Formula:C9H9NO2
InChI:InChI=1S/C9H9NO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,10H2,(H,11,12)/b6-3+
InChI key:JOLPMPPNHIACPD-ZZXKWVIFSA-N
SMILES:C1=CC(=CC=C1/C=C/C(=O)O)N
Synonyms:
  • 2-Propenoicacid, 3-(4-aminophenyl)-, (E)-
  • Cinnamic acid, p-amino-, (E)- (8CI)
  • (E)-4-Aminocinnamicacid
  • trans-p-Aminocinnamic acid
Found 3 products.