CAS 17573-94-3: 4-Ethynyl-N,N-dimethylaniline
Description:4-Ethynyl-N,N-dimethylaniline, with the CAS number 17573-94-3, is an organic compound characterized by its structure, which includes an ethynyl group attached to a dimethylaniline moiety. This compound typically appears as a liquid or solid, depending on the specific conditions, and is known for its aromatic properties due to the presence of the aniline structure. It is often used in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and other chemical products. The ethynyl group contributes to its reactivity, allowing for various chemical transformations, including coupling reactions. Additionally, 4-Ethynyl-N,N-dimethylaniline may exhibit moderate toxicity, necessitating appropriate safety precautions during handling. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. Overall, this compound is significant in the field of organic chemistry for its utility in synthesizing more complex molecules.
Formula:C10H11N
InChI:InChI=1S/C10H11N/c1-4-9-5-7-10(8-6-9)11(2)3/h1,5-8H,2-3H3
InChI key:InChIKey=ZWMAYLMVFSCMMS-UHFFFAOYSA-N
SMILES:C#CC1=CC=C(C=C1)N(C)C
- Synonyms:
- (4-Ethynyl-Phenyl)-Dimethyl-Amine
- (4-Ethynylphenyl)dimethylamine
- 1-(Dimethylamino)-4-ethynylbenzene
- 1-Ethynyl-4-(dimethylamino)benzene
- 1-Ethynyl-4-Dimethylaniline
- 4-(Dimethylamino)phenylethyne
- 4-Dimethylaminophenylacetylene
- 4-Ethynyl-N,N-Dimethylaniline
- 4-Ethynyl-N,N-Dimethylbenzenamine
- 4-Ethynyl-N,N-dimethylaminobenzene
- See more synonyms
- 4-Ethynylphenyl-N,N-dimethylamine
- 4-Phenylthiomorpholine 1,1-Dioxide
- Aniline, p-ethynyl-N,N-dimethyl-
- Benzenamine, 4-Ethynyl-N,N-Dimethyl-
- N,N-Dimethyl-4-Ethynylbenezeamine
- N,N-Dimethyl-4-ethynylaniline
- N,N-Methyl-4-ethynylaniline
- N-(4-Ethynylphenyl)-N,N-dimethylamine
- [4-(N,N-Dimethylamino)phenyl]acetylene
- [p-(Dimethylamino)phenyl]acetylene
- p-(N,N-Dimethylamino)phenylacetylene
- p-Ethynyl-N,N-dimethylaniline
