CymitQuimica logo

CAS 175774-12-6

:

(2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride

Description:
The chemical substance known as (2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methyl-3-pentanol hydrochloride, with the CAS number 175774-12-6, is a chiral compound characterized by its specific stereochemistry at the 2 and 3 positions, which contributes to its biological activity. This compound features a dimethylamino group, a methoxyphenyl moiety, and a pentanol backbone, indicating its potential as a pharmacologically active agent. The presence of the hydrochloride salt form enhances its solubility in aqueous solutions, making it suitable for various applications in medicinal chemistry. Its structural complexity suggests potential interactions with biological targets, which may include neurotransmitter systems, given the presence of the dimethylamino group. Additionally, the methoxy group may influence its lipophilicity and overall pharmacokinetic properties. As with many compounds of this nature, understanding its characteristics, including stability, reactivity, and biological effects, is crucial for its development in therapeutic contexts.
Formula:C15H26ClNO
InChI:InChI=1S/C15H25NO2.ClH/c1-6-15(17,12(2)11-16(3)4)13-8-7-9-14(10-13)18-5;/h7-10,12,17H,6,11H2,1-5H3;1H/t12-,15-;/m1./s1
SMILES:CC[C@@]([C@H](C)CN(C)C)(c1cccc(c1)OC)O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.