CAS 1758-54-9
:1-PYRIDIN-2-YLETHAN-1-ONE OXIME
Description:
1-Pyridin-2-ylethan-1-one oxime, with the CAS number 1758-54-9, is an organic compound characterized by its oxime functional group attached to a pyridine ring. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its unique chemical properties, including potential basicity and reactivity. The oxime functional group, characterized by the presence of a C=N-OH bond, imparts specific reactivity, particularly in condensation reactions and as a potential ligand in coordination chemistry. This compound may exhibit biological activity, making it of interest in medicinal chemistry and research. Its solubility can vary, often being soluble in polar organic solvents. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, 1-pyridin-2-ylethan-1-one oxime is a versatile compound with applications in various fields, including organic synthesis and pharmaceuticals.
Formula:C7H8N2O
InChI:InChI=1/C7H8N2O/c1-6(9-10)7-4-2-3-5-8-7/h2-5,8H,1H3
SMILES:CC(=c1cccc[nH]1)N=O
Synonyms:- 1-Pyridin-2-Yl-Ethanone Oxime
- 1-(2-Pyridinyl)-1-Ethanone Oxime
- (2Z)-2-(1-nitrosoethylidene)-1,2-dihydropyridine
- 2-(1-Nitrosoethylidene)-1,2-Dihydropyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-pyridyl ketoxime, 97%
CAS:Methyl-2-pyridyl ketoxime is used as colorimetric reagent for rhenium. Methyl-2-pyridyl ketoxime has been proposed as an analytical reagent for the spectrophotometric determination of copper, iron in alkaline aqueous solution and phenyl-2 pyridyl ketoxime. This Thermo Scientific Chemicals brand prod
Formula:C7H8N2OPurity:97%Molecular weight:136.15Ethanone, 1-(2-pyridinyl)-, oxime
CAS:Formula:C7H8N2OPurity:97%Color and Shape:SolidMolecular weight:136.15121-Pyridin-2-ylethan-1-one oxime
CAS:1-Pyridin-2-ylethan-1-one oximePurity:≥95%Color and Shape:Colourless PowderMolecular weight:136.15g/mol



