CAS 175845-21-3
:2,8,9-TRI-I-PROPYL-2,5,8,9-TETRAAZA-1-PHOSPHABICYCLO[3.3.3]UNDECANE
Description:
2,8,9-Tri-i-propyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane, with CAS number 175845-21-3, is a complex organic compound featuring a bicyclic structure that incorporates both nitrogen and phosphorus atoms. This compound is characterized by its unique arrangement of four nitrogen atoms and one phosphorus atom within a bicyclic framework, which contributes to its potential applications in coordination chemistry and catalysis. The presence of tri-isopropyl groups enhances its solubility and steric bulk, which can influence its reactivity and interaction with other chemical species. The tetraaza and phosphabicyclo structure may impart interesting electronic properties, making it a candidate for studies in materials science and organic synthesis. Additionally, the compound's stability and reactivity can be affected by the steric hindrance provided by the propyl groups, which may also play a role in its biological activity or potential as a ligand in metal coordination complexes. Overall, this compound represents a fascinating area of study within the field of organophosphorus chemistry.
Formula:C15H33N4P
InChI:InChI=1/C15H33N4P/c1-13(2)17-10-7-16-8-11-18(14(3)4)20(17)19(12-9-16)15(5)6/h13-15H,7-12H2,1-6H3
SMILES:CC(C)N1CCN2CCN(C(C)C)P1N(CC2)C(C)C
Synonyms:- 2,5,8,9-Tetraaza-1-Phosphabicyclo[3.3.3]Undecane,2,8,9-Tris(1-Methylethyl)
- 2,8,9-Triisopropyl-2,5,8,9-Tetraaza-1-Phosphabicyclo[3.3.3]Undecane
- 2,8,9-Triisopropyl-2,5,8,9-Tetraza-1-Phosphabicyclo[3.3.3]Undecane
- 2,8,9-Triisopropyl-2,5,8,9-Tetraaza-1-P&
- 2,8,9-Triisopropyl-2,5,8,9-Tetraza-1-Ph&
- 2,8,9-Triisopropyl-2,5,8,9-Tetraza-1-Phosphabicyclo[3.3.3]Undecane Solution
- 2,8,9-Tris(1-Methylethyl)-2,5,8,9-Tetraaza-1-Phosphabicyclo[3.3.3]Undecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,5,8,9-Tetraaza-1-phosphabicyclo[3.3.3]undecane, 2,8,9-tris(1-methylethyl)-
CAS:Formula:C15H33N4PColor and Shape:LiquidMolecular weight:300.42312,8,9-Tri-i-propyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane
CAS:2,8,9-Tri-i-propyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane
Formula:C15H33N4PColor and Shape:yellow liq.Molecular weight:300.42

