CAS 17587-22-3: 6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedione
Description:6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedione, with CAS number 17587-22-3, is a fluorinated organic compound characterized by its unique structure that includes multiple fluorine atoms and a diketone functional group. This compound features a central octanedione backbone, which contributes to its reactivity and potential applications in various chemical processes. The presence of heptafluoro groups enhances its thermal stability and hydrophobic properties, making it useful in specialized applications such as in the synthesis of fluorinated materials and as a potential intermediate in organic synthesis. Additionally, the compound's fluorinated nature may impart unique electronic and physical properties, such as low surface tension and high chemical resistance. Its specific characteristics, including boiling point, melting point, and solubility, would depend on the molecular interactions and the environment in which it is used. Safety data sheets should be consulted for handling and storage guidelines, as fluorinated compounds can exhibit toxicity and environmental persistence.
Formula:C10H11F7O2
InChI:InChI=1S/C10H11F7O2/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17/h4H2,1-3H3
InChI key:InChIKey=SQNZLBOJCWQLGQ-UHFFFAOYSA-N
SMILES:O=C(CC(=O)C(C)(C)C)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- (5Z)-1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one
- (Heptafluorobutanoyl)pivaloylmethane
- 1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyl-4,6-octanedione
- 2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-heptanedione
- 3,5-Octanedione, 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-
- 6,6,7,7,8,8,8-Heptafluoro-2,2-Dimethyloctane-3,5-Dione
- 6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedione
- 7,7-Dimethyl-1,1,1,2,2,3,3-heptafluoro-4,6-octanedione~Fod-H~Hfod
- Heptafluorobutyrylpivaloylmethane
- 2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione
- See more synonyms
- Fod
