CAS 17587-22-3
:6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedione
Description:
6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedione, with CAS number 17587-22-3, is a fluorinated organic compound characterized by its unique structure that includes multiple fluorine atoms and a diketone functional group. This compound features a central octanedione backbone, which contributes to its reactivity and potential applications in various chemical processes. The presence of heptafluoro groups enhances its thermal stability and hydrophobic properties, making it useful in specialized applications such as in the synthesis of fluorinated materials and as a potential intermediate in organic synthesis. Additionally, the compound's fluorinated nature may impart unique electronic and physical properties, such as low surface tension and high chemical resistance. Its specific characteristics, including boiling point, melting point, and solubility, would depend on the molecular interactions and the environment in which it is used. Safety data sheets should be consulted for handling and storage guidelines, as fluorinated compounds can exhibit toxicity and environmental persistence.
Formula:C10H11F7O2
InChI:InChI=1S/C10H11F7O2/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17/h4H2,1-3H3
InChI key:InChIKey=SQNZLBOJCWQLGQ-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)(F)F)(C(CC(C(C)(C)C)=O)=O)(F)F
Synonyms:- (5Z)-1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloct-5-en-4-one
- (Heptafluorobutanoyl)pivaloylmethane
- 1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyl-4,6-octanedione
- 2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-heptanedione
- 3,5-Octanedione, 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-
- 6,6,7,7,8,8,8-Heptafluoro-2,2-Dimethyloctane-3,5-Dione
- 6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedione
- 7,7-Dimethyl-1,1,1,2,2,3,3-heptafluoro-4,6-octanedione~Fod-H~Hfod
- Heptafluorobutyrylpivaloylmethane
- 2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione
- Fod
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione
CAS:Formula:C10H11F7O2Purity:>97.0%(GC)Color and Shape:White - Yellow LiquidMolecular weight:296.186,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedione, 98+% HFOD
CAS:<p>6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedione, 98+% HFOD</p>Formula:C3F7C(O)CH2C(O)C(CH3)3Purity:98+%Color and Shape:colorless to pale yellow liq.Molecular weight:296.193,5-Octanedione, 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-
CAS:Formula:C10H11F7O2Purity:95%Color and Shape:LiquidMolecular weight:296.18202,2-Dimethyl-6,6,7,7,8,8,8-heptafluorooctane-3,5-dione
CAS:<p>2,2-Dimethyl-6,6,7,7,8,8,8-heptafluorooctane-3,5-dione</p>Formula:C10H11F7O2Purity:97%Color and Shape: clear liquidMolecular weight:296.18g/mol2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione
CAS:Formula:C10H11F7O2Purity:98%Color and Shape:LiquidMolecular weight:296.1852,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione
CAS:2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione is a bidentate ligand for metal ions. It has been shown to be effective in the synthesis of nanocrystals and the activation energy for the reaction has been determined to be 70.4 kJ/mol. 2DMMHFO can be used as a precursor for the growth of silicon films by chemical vapor deposition and other techniques. The molecule has also been shown to bind with metal ions such as Cu(II) and Fe(III), which may be due to its ability to chelate these metals. 2DMMHFO has been used as an efficient catalyst in asymmetric epoxidation reactions with high enantioselectivity.Formula:C10H11F7O2Purity:Min. 95%Molecular weight:296.18 g/mol





