CAS 175870-40-3
:2,3-Dihydro-1-[3-(phenylmethoxy)propyl]-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]-1H-indole-7-carboxamide
Description:
2,3-Dihydro-1-[3-(phenylmethoxy)propyl]-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]-1H-indole-7-carboxamide, with CAS number 175870-40-3, is a synthetic compound characterized by its complex molecular structure, which includes an indole core, a carboxamide functional group, and multiple aromatic and aliphatic substituents. This compound exhibits properties typical of indole derivatives, such as potential biological activity, which may include interactions with various receptors or enzymes. The presence of trifluoroethoxy and phenylmethoxy groups suggests lipophilicity, which can influence its pharmacokinetic properties, including absorption and distribution in biological systems. Additionally, the stereochemistry indicated by the (2R) configuration may play a crucial role in its biological activity and interaction with target proteins. Overall, this compound is of interest in medicinal chemistry, particularly for its potential therapeutic applications, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C32H38F3N3O4
InChI:InChI=1S/C32H38F3N3O4/c1-23(37-13-17-41-28-10-5-6-11-29(28)42-22-32(33,34)35)18-25-19-26-12-15-38(30(26)27(20-25)31(36)39)14-7-16-40-21-24-8-3-2-4-9-24/h2-6,8-11,19-20,23,37H,7,12-18,21-22H2,1H3,(H2,36,39)/t23-/m1/s1
InChI key:InChIKey=SWXREGRXRIZTPZ-HSZRJFAPSA-N
SMILES:C(CCOCC1=CC=CC=C1)N2C=3C(=CC(C[C@H](NCCOC4=C(OCC(F)(F)F)C=CC=C4)C)=CC3C(N)=O)CC2
Synonyms:- 2,3-Dihydro-1-[3-(phenylmethoxy)propyl]-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]-1H-indole-7-carboxamide
- 1H-Indole-7-carboxamide, 2,3-dihydro-1-[3-(phenylmethoxy)propyl]-5-[(2R)-2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]-
- 1H-Indole-7-carboxamide, 2,3-dihydro-1-[3-(phenylmethoxy)propyl]-5-[2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]-, (R)-
- (R)-1-(3-Benzyloxypropyl)-5-[2-[[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl]amino]propyl]indoline-7-carboxamide
- Benzyl Silodosin Q: What is the CAS Number of
- Silodosin Impurity 61
- Benzyl SilodosinQ: What is
- Benzyl Silodosin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Benzyl Silodosin
CAS:Controlled ProductFormula:C32H38F3N3O4Color and Shape:NeatMolecular weight:585.657

