
CAS 17589-24-1
:1,3-Bis[4-[(4-isocyanatophenyl)methyl]phenyl]-1,3-diazetidine-2,4-dione
Description:
1,3-Bis[4-[(4-isocyanatophenyl)methyl]phenyl]-1,3-diazetidine-2,4-dione, commonly referred to by its CAS number 17589-24-1, is a complex organic compound characterized by its unique diazetidine structure and the presence of isocyanate functional groups. This compound typically exhibits a high degree of reactivity due to the isocyanate groups, which can participate in various chemical reactions, including nucleophilic addition and polymerization. It is often utilized in the synthesis of polyurethanes and other polymeric materials, owing to its ability to form strong covalent bonds with nucleophiles. The presence of multiple aromatic rings contributes to its stability and potential applications in materials science. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents and thermal stability, making it suitable for various industrial applications. However, due to the isocyanate functionality, it is essential to handle this compound with care, as isocyanates can be hazardous and require appropriate safety measures during use.
Formula:C30H20N4O4
InChI:InChI=1S/C30H20N4O4/c35-19-31-25-9-1-21(2-10-25)17-23-5-13-27(14-6-23)33-29(37)34(30(33)38)28-15-7-24(8-16-28)18-22-3-11-26(12-4-22)32-20-36/h1-16H,17-18H2
InChI key:InChIKey=ARRNPOPZVLSDGB-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)N1C2=CC=C(CC3=CC=C(N=C=O)C=C3)C=C2)C4=CC=C(CC5=CC=C(N=C=O)C=C5)C=C4
Synonyms:- 1,3-Diazetidine-2,4-dione, 1,3-bis[4-[(4-isocyanatophenyl)methyl]phenyl]-
- Isocyanic acid, (2,4-dioxo-1,3-uretidinediyl)bis(p-phenylenemethylene-p-phenylene) ester
- 1,3-Bis[4-[(4-isocyanatophenyl)methyl]phenyl]-1,3-diazetidine-2,4-dione
- 2,4-Uretidinedione, 1,3-bis[α-(p-isocyanatophenyl)-p-tolyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,3-Bis(4-(4-Isocyanatobenzyl)phenyl)-1,3-Diazetidine-2,4-Dione
CAS:Formula:C30H20N4O4Molecular weight:500.511,3-Bis(4-(4-Isocyanatobenzyl)phenyl)-1,3-Diazetidine-2,4-Dione
CAS:Formula:C30H20N4O4Molecular weight:500.51

