CAS 1759-58-6
:trans-1,3-Dimethylcyclopentane
Description:
Trans-1,3-Dimethylcyclopentane is a cyclic hydrocarbon with the molecular formula C7H14. It features a cyclopentane ring with two methyl groups attached at the 1 and 3 positions, which gives it a trans configuration. This structural arrangement influences its physical and chemical properties, including its boiling and melting points, which are typically higher than those of non-substituted cyclopentane due to increased molecular interactions. Trans-1,3-Dimethylcyclopentane is a colorless liquid at room temperature and is relatively nonpolar, making it soluble in organic solvents but not in water. It is primarily used in organic synthesis and as a solvent in various chemical reactions. The compound exhibits typical alkane reactivity, including combustion and substitution reactions, but is less reactive than alkenes or alkynes. Its unique structure also allows for interesting conformational isomerism, which can affect its reactivity and interactions with other molecules. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C7H14
InChI:InChI=1/C7H14/c1-6-3-4-7(2)5-6/h6-7H,3-5H2,1-2H3/t6-,7-/s2
InChI key:InChIKey=XAZKFISIRYLAEE-WZTWBHKBNA-N
SMILES:C[C@H]1C[C@H](C)CC1
Synonyms:- (1R,3R)-1,3-dimethylcyclopentane
- 1,3-Dimethylcyclopentane, trans
- 1,trans-3-Dimethylcyclopentane
- Cyclopentane, 1,3-dimethyl-, (1R,3R)-rel-
- Cyclopentane, 1,3-dimethyl-, trans-
- Cyclopentane,1,Trans-3-Dimethyl-
- NSC 74148
- T-1,3-Dimethylcyclopentane
- Trans-1,3-Dimethylcyclopentane
- rel-(1R,3R)-1,3-Dimethylcyclopentane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
trans-1,3-Dimethylcyclopentane-d4
CAS:Controlled ProductFormula:C7D4H10Color and Shape:NeatMolecular weight:102.211

