CAS 17592-23-3
:3-Methoxy-4-hydroxyphenylglycolaldehyde
Description:
3-Methoxy-4-hydroxyphenylglycolaldehyde, with the CAS number 17592-23-3, is an organic compound characterized by its phenolic structure, which includes a methoxy group and a hydroxyl group on a benzene ring. This compound features a glycolaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a white to light yellow solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of hydroxyl and methoxy groups, which enhance its hydrophilicity. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structure allows for various chemical reactions, including oxidation and condensation, which can be utilized in the synthesis of more complex molecules. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity. Overall, 3-Methoxy-4-hydroxyphenylglycolaldehyde is a versatile compound with implications in both synthetic chemistry and biological applications.
Formula:C9H10O4
InChI:InChI=1S/C9H10O4/c1-13-9-4-6(8(12)5-10)2-3-7(9)11/h2-5,8,11-12H,1H3
InChI key:InChIKey=VISAJVAPYPFKCL-UHFFFAOYSA-N
SMILES:C(C=O)(O)C1=CC(OC)=C(O)C=C1
Synonyms:- Benzeneacetaldehyde, α,4-dihydroxy-3-methoxy-
- 4-Hydroxy-3-methoxyphenylglycolaldehyde
- α,4-Dihydroxy-3-methoxybenzeneacetaldehyde
- Mandelaldehyde, 4-hydroxy-3-methoxy-
- 3-Methoxy-4-hydroxyphenylglycolaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
