CAS 175965-83-0

Pyridine, 2-fluoro-4-methoxy- (9CI)

Description:

Pyridine, 2-fluoro-4-methoxy- (9CI), with the CAS number 175965-83-0, is an organic compound that belongs to the class of heterocyclic aromatic compounds. It features a pyridine ring, which is a six-membered ring containing one nitrogen atom, and is substituted with a fluorine atom at the 2-position and a methoxy group (-OCH3) at the 4-position. This compound exhibits characteristics typical of pyridine derivatives, including basicity due to the nitrogen atom, which can participate in protonation reactions. The presence of the fluorine atom can influence the compound's reactivity and polarity, while the methoxy group can enhance solubility in organic solvents. Pyridine derivatives are often used in the synthesis of pharmaceuticals, agrochemicals, and as intermediates in organic reactions. The specific substitution pattern of this compound may impart unique properties, making it of interest in various chemical applications, including potential roles in medicinal chemistry and material science. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₆H₆FNO

InChI: InChI=1/C6H6FNO/c1-9-5-2-3-8-6(7)4-5/h2-4H,1H3

SMILES: COc1ccnc(c1)F

Synonyms:

• 2-Fluoro-4-Methoxypyridine

Pyridine, 2-fluoro-4-methoxy-

CAS: 175965-83-0

Formula: C₆H₆FNO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 127.1163

Ref: IN-DA0021BE

2-Fluoro-4-methoxypyridine

CAS: 175965-83-0

2-Fluoro-4-methoxypyridine

Formula: C₆H₆FNO

Purity: 97%

Color and Shape: colourless liquid

Molecular weight: 127.12g/mol

Ref: 54-PC520798

2-Fluoro-4-methoxypyridine

CAS: 175965-83-0

Formula: C₆H₆FNO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 127.118

Ref: 10-F043905