CAS 176-33-0
:1,4-DIOXA-7-AZA-SPIRO[4.4]NONANE
Description:
1,4-Dioxo-7-aza-spiro[4.4]nonane, with the CAS number 176-33-0, is a heterocyclic organic compound characterized by its unique spirocyclic structure, which includes both a dioxane and a nitrogen atom integrated into the ring system. This compound features a bicyclic framework where the spiro junction connects two rings, contributing to its distinct three-dimensional shape. The presence of the nitrogen atom in the ring enhances its potential for forming hydrogen bonds, which can influence its solubility and reactivity. Typically, compounds of this nature may exhibit interesting biological activities, making them of interest in medicinal chemistry and drug design. The physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and the presence of substituents. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the nitrogen and oxygen atoms within the structure. Overall, 1,4-dioxo-7-aza-spiro[4.4]nonane represents a fascinating area of study within organic and medicinal chemistry.
Formula:C7H13NO
InChI:InChI=1/C7H13NO/c1-2-4-7(3-1)8-5-6-9-7/h8H,1-6H2
SMILES:C1CCC2(C1)NCCO2
Synonyms:- 1-Oxa-4-Azaspiro[4.4]Nonane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,4-dioxa-7-azaspiro[4.4]nonane
CAS:Formula:C6H11NO2Purity:97%Color and Shape:LiquidMolecular weight:129.15701,4-Dioxa-7-azaspiro[4.4]nonane
CAS:1,4-Dioxa-7-azaspiro[4.4]nonanePurity:98%Molecular weight:129.16g/mol1,4-Dioxa-7-azaspiro[4.4]nonane
CAS:Formula:C6H11NO2Purity:98%Color and Shape:LiquidMolecular weight:129.1591,4-Dioxa-7-azaspiro[4.4]nonane
CAS:<p>1,4-Dioxa-7-azaspiro[4.4]nonane is a replication inhibitor that has been shown to be active against hepatitis C virus (HCV) genotype 1b. It has potent antiviral activity and is selective for HCV RNA polymerase over host cell RNA polymerase. High doses of this drug are required for inhibition of HCV replication. The safety data from clinical trials on 1,4-dioxa-7-azaspiro[4.4]nonane have not been reported yet. This compound interacts with many other drugs and may affect their pharmacokinetics. The potency of this compound is high, but it also has low solubility in water and can only be administered intravenously or by inhalation.</p>Formula:C6H11NO2Purity:Min. 95%Molecular weight:129.16 g/mol




