CAS 176-64-7
:8-Azaspiro[4.5]decane
Description:
8-Azaspiro[4.5]decane, with the CAS number 176-64-7, is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom incorporated into a bicyclic framework. This compound features a spiro connection between two rings, contributing to its rigidity and distinct three-dimensional shape. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the nitrogen atom in its structure imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. 8-Azaspiro[4.5]decane is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. Its physical properties, such as boiling point and solubility, can vary based on the specific isomer and environmental conditions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H17N
InChI:InChI=1S/C9H17N/c1-2-4-9(3-1)5-7-10-8-6-9/h10H,1-8H2
InChI key:InChIKey=AXMNGEUJXLXFRY-UHFFFAOYSA-N
SMILES:C12(CCNCC1)CCCC2
Synonyms:- Piperidine, 4,4-(1,4-butanediyl)-
- 8-Azaspiro[4.5]decane
- 4,4-(1,4-Butanediyl)piperidine
- Spiro[cyclopentane-1,4′-piperidine]
- 4,4-Tetramethylenepiperidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
8-Aza-spiro[4.5]decane
CAS:8-Aza-spiro[4.5]decane is an amide and organometallic compound that has been shown to have anti-inflammatory properties, as well as being useful in the treatment of inflammatory pain. It binds to the urothelium, which is the lining of the bladder and urinary tract, or to cells in the intestinal lumen, leading to a reduction in inflammation. 8-Aza-spiro[4.5]decane also has been shown to be effective in treating depression, due to its ability to bind with serotonin receptors. This drug has fluorine in its structure which can cause alzheimer's disease or other neurodegenerative disorders when combined with organic acids such as fatty acid.
Formula:C9H17NPurity:Min. 95%Molecular weight:139.24 g/mol




