CAS 176-67-0
:2,8-Diazaspiro[4.5]decane
Description:
2,8-Diazaspiro[4.5]decane, with the CAS number 176-67-0, is a bicyclic organic compound characterized by its unique spiro structure, which consists of two nitrogen atoms incorporated into a decane framework. This compound features a spiro connection between two rings, contributing to its distinctive three-dimensional shape. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of nitrogen atoms in its structure imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. 2,8-Diazaspiro[4.5]decane is of interest in medicinal chemistry and materials science due to its potential applications in drug design and as a building block for more complex molecules. Its stability and reactivity can be influenced by the surrounding functional groups and the overall molecular environment. As with many nitrogen-containing compounds, it may exhibit interesting biological activities, making it a subject of research in various fields.
Formula:C8H16N2
InChI:InChI=1S/C8H16N2/c1-4-9-5-2-8(1)3-6-10-7-8/h9-10H,1-7H2
InChI key:InChIKey=WYZZNMWIWHRXRM-UHFFFAOYSA-N
SMILES:C12(CCNCC1)CCNC2
Synonyms:- 2,8-Diazaspiro[4.5]decane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,8-Diazaspiro[4.5]decane
CAS:Formula:C8H16N2Purity:95%Color and Shape:SolidMolecular weight:140.22602,8-Diazaspiro[4.5]decane
CAS:<p>2,8-Diazaspiro[4.5]decane is a competitive antagonist of the receptor α-adrenergic. It has been shown to significantly activate ATP-binding cassette transporter proteins in bone cells and increase bone mass. 2,8-Diazaspiro[4.5]decane is also an enantiomer that can be used for the treatment of cancer, as well as other diseases such as depression and anxiety. The pharmacokinetic properties of this drug have been studied in rats and mice with significant concentration levels achieved in plasma after 1 hour. The half-life of 2,8-Diazaspiro[4.5]decane is 3 hours and it is metabolized by hydrolysis by carboxylesterase or hydroxylase enzymes to form an inactive compound.</p>Formula:C8H16N2Purity:Min. 95%Molecular weight:140.23 g/mol



