CAS 176032-78-3

3-(1H-1,2,4-TRIAZOL-1-YL)ANILINE

Description:

3-(1H-1,2,4-Triazol-1-yl)aniline, with the CAS number 176032-78-3, is an organic compound characterized by the presence of both an aniline group and a triazole ring. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the presence of the amino group. The triazole moiety contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of antifungal and antimicrobial agents. The compound may also exhibit various functional properties, such as the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. Additionally, its structure suggests potential applications in materials science and as a ligand in coordination chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity associated with amines and heterocycles.

Formula: C₈H₈N₄

InChI: InChI=1/C8H8N4/c9-7-2-1-3-8(4-7)12-6-10-5-11-12/h1-6H,9H2

SMILES: c1cc(cc(c1)n1cncn1)N

Synonyms:

• 1-(3-Aminophenyl)-1H-1,2,4-triazole
• 3-(1H-1,2,4-Triazol-1-yl)aniline 90%

Benzenamine, 3-(1H-1,2,4-triazol-1-yl)-

CAS: 176032-78-3

Formula: C₈H₈N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.1759

Ref: IN-DA0021DF

3-(1H-1,2,4-Triazol-1-yl)aniline

CAS: 176032-78-3

3-(1H-1,2,4-Triazol-1-yl)aniline

Purity: 97%

Color and Shape: Beige Solid

Molecular weight: 160.18g/mol

Ref: 54-OR9139

3-(1H-1,2,4-Triazol-1-yl)aniline

CAS: 176032-78-3

Formula: C₈H₈N₄

Purity: 98%

Molecular weight: 160.18

Ref: 10-F064771