CAS 176034-12-1

3-[(E)-2-pyridin-2-ylethenyl]aniline

Description:

3-[(E)-2-pyridin-2-ylethenyl]aniline, with the CAS number 176034-12-1, is an organic compound characterized by its structure, which includes an aniline moiety and a pyridine ring connected by a vinyl group. This compound features a double bond between the carbon atoms of the vinyl group, contributing to its reactivity and potential for participating in various chemical reactions, such as electrophilic substitutions or polymerization processes. The presence of the pyridine ring imparts basic properties and can influence the compound's solubility and interaction with other molecules. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of functional groups. Overall, 3-[(E)-2-pyridin-2-ylethenyl]aniline is a versatile compound with potential applications in various fields, including organic synthesis and pharmaceuticals.

Formula: C₁₃H₁₂N₂

InChI: InChI=1/C13H12N2/c14-12-5-3-4-11(10-12)7-8-13-6-1-2-9-15-13/h1-10H,14H2/b8-7+

3-[(E)-2-pyridin-2-ylvinyl]aniline

CAS: 176034-12-1

Formula: C₁₃H₁₂N₂

Molecular weight: 196.2478

Ref: IN-DA0021DC

3-[(E)-2-pyridin-2-ylvinyl]aniline

CAS: 176034-12-1

Formula: C₁₃H₁₂N₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 196.253

Ref: 10-F308294

3-[(E)-2-Pyridin-2-ylvinyl]aniline

CAS: 176034-12-1

Versatile small molecule scaffold

Formula: C₁₃H₁₂N₂

Purity: Min. 95%

Molecular weight: 196.25 g/mol

Ref: 3D-BHA03412