CAS 176036-42-3
:L-Proline, 1-(3-mercapto-2-methyl-1-oxopropyl)-, 1-methylethyl ester, (S)-
Description:
L-Proline, 1-(3-mercapto-2-methyl-1-oxopropyl)-, 1-methylethyl ester, (S)-, identified by CAS number 176036-42-3, is a chemical compound that features a proline backbone modified with a mercapto group and an ester functional group. This compound is characterized by its chiral nature, specifically the (S)-enantiomer, which is significant in biological systems where chirality can influence activity and interaction with biological receptors. The presence of the mercapto group suggests potential reactivity, particularly in forming disulfide bonds or participating in nucleophilic reactions. The ester functionality indicates that it may undergo hydrolysis, making it relevant in various chemical and biological processes. Additionally, the methyl and ethyl groups contribute to its hydrophobic characteristics, which can affect solubility and permeability in biological membranes. Overall, this compound may have applications in pharmaceuticals, biochemistry, and materials science, particularly in contexts where proline derivatives are utilized for their unique structural and functional properties.
Formula:C12H21NO3S
InChI:InChI=1S/C12H21NO3S/c1-8(2)16-12(15)10-5-4-6-13(10)11(14)9(3)7-17/h8-10,17H,4-7H2,1-3H3/t9-,10+/m1/s1
InChI key:InChIKey=KMIOVNOWZMWMBH-ZJUUUORDSA-N
SMILES:C(OC(C)C)(=O)[C@H]1N(C([C@@H](CS)C)=O)CCC1
Synonyms:- L-Proline, 1-(3-mercapto-2-methyl-1-oxopropyl)-, 1-methylethyl ester, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Captopril Isopropyl Ester
CAS:Controlled ProductFormula:C12H21NO3SColor and Shape:NeatMolecular weight:259.36
