CAS 176039-39-7
:N-boc-N'-fmoc-diaminoacetic acid
Description:
N-Boc-N'-Fmoc-diaminoacetic acid is a protected amino acid commonly used in peptide synthesis and drug development. It features two distinct protective groups: the Boc (tert-butyloxycarbonyl) group, which provides stability and prevents premature reactions during synthesis, and the Fmoc (9-fluorenylmethoxycarbonyl) group, which allows for selective deprotection under mild conditions. This compound contains two amino groups and a carboxylic acid, making it a versatile building block for constructing peptides with specific functionalities. Its structure enhances solubility in organic solvents, facilitating its use in various chemical reactions. The presence of both amino and carboxylic acid functional groups allows for the formation of peptide bonds, making it suitable for solid-phase peptide synthesis. Additionally, the protective groups can be selectively removed, enabling the introduction of further modifications or the assembly of complex peptide structures. Overall, N-Boc-N'-Fmoc-diaminoacetic acid is a valuable intermediate in the field of medicinal chemistry and peptide research.
Formula:C22H24N2O6
InChI:InChI=1/C22H24N2O6/c1-22(2,3)30-21(28)24-18(19(25)26)23-20(27)29-12-17-15-10-6-4-8-13(15)14-9-5-7-11-16(14)17/h4-11,17-18H,12H2,1-3H3,(H,23,27)(H,24,28)(H,25,26)
SMILES:CC(C)(C)OC(=NC(C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12)O
Synonyms:- Boc-.alpha.-(Fmoc-amino)-DL-Gly-OH
- [(tert-butoxycarbonyl)amino]{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(9H-Fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid
CAS:Formula:C22H24N2O6Purity:95%Color and Shape:SolidMolecular weight:412.43582-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-((tert-butoxycarbonyl)amino)acetic acid
CAS:2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-((tert-butoxycarbonyl)amino)acetic acidPurity:95%Molecular weight:412.44g/molFmoc-α-amino-DL-Gly(Boc)-OH
CAS:Has been used as a template for the introduction of betidamino acid in bioactive peptides. The structural constraints introduced by the presence of a betidamino acid were of particular interest in the identification of bioactive conformations of peptide hormones and for the design of receptor selective analogs.Formula:C22H24N2O6Purity:98.1%Color and Shape:White PowderMolecular weight:412.44




