CAS 17606-70-1
:4-benzylidene-2-phenyl-2-oxazolin-5-one
Description:
4-Benzylidene-2-phenyl-2-oxazolin-5-one, also known by its CAS number 17606-70-1, is an organic compound characterized by its oxazolinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic synthesis and as a fluorescent dye. It possesses a conjugated system due to the presence of the benzylidene and phenyl groups, which can contribute to its electronic properties and reactivity. The compound is generally soluble in organic solvents, making it suitable for various chemical reactions. Its unique structure allows it to participate in cycloaddition reactions and other transformations, making it of interest in materials science and medicinal chemistry. Additionally, the presence of the oxazolinone moiety may impart biological activity, although specific biological properties would require further investigation. Overall, 4-benzylidene-2-phenyl-2-oxazolin-5-one is a versatile compound with potential utility in multiple fields of research.
Formula:C16H11NO2
InChI:InChI=1/C16H11NO2/c18-16-14(11-12-7-3-1-4-8-12)17-15(19-16)13-9-5-2-6-10-13/h1-11H/b14-11-
SMILES:c1ccc(cc1)/C=C\1/C(=O)OC(=N1)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(Z)-4-Benzylidene-2-phenyloxazol-5(4H)-one
CAS:Formula:C16H11NO2Color and Shape:SolidMolecular weight:249.2640
