CymitQuimica logo

CAS 17610-21-8

:

1-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethan-1-one

Description:
1-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethan-1-one, with the CAS number 17610-21-8, is an organic compound characterized by its complex structure, which includes a tetrahydronaphthalene moiety substituted with multiple methyl groups. This compound typically exhibits a high degree of hydrophobicity due to its bulky hydrocarbon framework, making it less soluble in polar solvents. It is often used in organic synthesis and may serve as an intermediate in the production of various chemical products. The presence of a ketone functional group (ethan-1-one) indicates that it can participate in reactions typical of carbonyl compounds, such as nucleophilic addition. Additionally, the steric hindrance provided by the tetramethyl groups can influence its reactivity and stability. The compound may also exhibit interesting physical properties, such as a distinctive melting point and boiling point, which are influenced by its molecular structure. Overall, this compound is of interest in both synthetic organic chemistry and materials science.
Formula:C16H22O
InChI:InChI=1/C16H22O/c1-11(17)12-6-7-13-14(10-12)16(4,5)9-8-15(13,2)3/h6-7,10H,8-9H2,1-5H3
InChI key:IHUSZOMIBSDQTB-UHFFFAOYSA-N
SMILES:CC(=O)c1ccc2c(c1)C(C)(C)CCC2(C)C
Synonyms:
  • 6-Acetyl-1,2,3,4-tetrahydro-1,1,4,4-tetramethylnaphtalene
  • 1-(5,5,8,8-Tetramethyl-5,6,7,8-Tetrahydronaphthalen-2-Yl)Ethanone
  • 1-(5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-naphthalen-2-yl)-ethanone
Found 3 products.