CAS 17610-48-9
:dicyclopentylmethanone
Description:
Dicyclopentylmethanone, with the CAS number 17610-48-9, is an organic compound characterized by its ketone functional group and a unique bicyclic structure. It features two cyclopentyl groups attached to a central carbonyl (C=O) moiety, which contributes to its distinct chemical properties. This compound is typically a colorless to pale yellow liquid with a relatively low volatility, making it less prone to evaporation compared to smaller ketones. Dicyclopentylmethanone is known for its stability under standard conditions and is often utilized in organic synthesis and as a potential intermediate in the production of various chemical products. Its molecular structure imparts certain hydrophobic characteristics, influencing its solubility in organic solvents while being less soluble in water. Additionally, it may exhibit interesting reactivity patterns typical of ketones, such as undergoing nucleophilic addition reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H18O
InChI:InChI=1/C11H18O/c12-11(9-5-1-2-6-9)10-7-3-4-8-10/h9-10H,1-8H2
SMILES:C1CCC(C1)C(=O)C1CCCC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Dicyclopentylmethanone
CAS:<p>Dicyclopentylmethanone is an anabolic agent that is used as a progestational, antibiotic, or antiviral agent. It binds to the hydroxy group of the enzyme's active site and inhibits it from binding to its substrate. Dicyclopentylmethanone also has antiviral activity against some viruses by binding to their ribonucleic acid (RNA) and preventing viral replication. This drug may be used in vaccines to stimulate antibody production, but it has not been approved for this use.</p>Formula:C11H18OPurity:Min. 95%Molecular weight:166.26 g/mol

