CAS 17613-25-1

3-(3,4-dihydroisoquinolin-2(1H)-yl)-3-oxopropanenitrile

Description:

3-(3,4-dihydroisoquinolin-2(1H)-yl)-3-oxopropanenitrile, with the CAS number 17613-25-1, is a chemical compound that features a complex structure incorporating both a nitrile and an isoquinoline moiety. This compound typically exhibits characteristics common to nitriles, such as being polar and capable of participating in various chemical reactions, including nucleophilic additions. The presence of the isoquinoline structure suggests potential biological activity, as many isoquinoline derivatives are known for their pharmacological properties. The compound may be solid at room temperature and is likely to be soluble in organic solvents, reflecting the general solubility trends of similar organic compounds. Its reactivity can be influenced by the functional groups present, making it a candidate for further chemical transformations. Additionally, the compound's unique structure may allow for specific interactions in biological systems, warranting investigation in medicinal chemistry or related fields. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic applications.

Formula: C₁₂H₁₂N₂O

InChI: InChI=1/C12H12N2O/c13-7-5-12(15)14-8-6-10-3-1-2-4-11(10)9-14/h1-4H,5-6,8-9H2

SMILES: c1ccc2CN(CCc2c1)C(=O)CC#N

3-oxo-3-(1,2,3,4-tetrahydroisoquinolin-2-yl)propanenitrile

CAS: 17613-25-1

Formula: C₁₂H₁₂N₂O

Molecular weight: 200.2365

Ref: IN-DA0021G7

3-(3,4-Dihydroisoquinolin-2(1H)-yl)-3-oxopropanenitrile

CAS: 17613-25-1

Purity: 98%

Molecular weight: 200.2409973

Ref: 10-F727686