CAS 176199-51-2

Ethyl 2′,5′-dioxospiro[bicyclo[3.1.0]hexane-2,4′-imidazolidine]-6-carboxylate

Description:

Ethyl 2′,5′-dioxospiro[bicyclo[3.1.0]hexane-2,4′-imidazolidine]-6-carboxylate, identified by its CAS number 176199-51-2, is a complex organic compound characterized by its unique bicyclic structure and the presence of both imidazolidine and carboxylate functional groups. This compound features a spiro arrangement, which contributes to its rigidity and potential for interesting stereochemical properties. The presence of dioxo groups indicates that it has two carbonyl functionalities, which can enhance its reactivity and potential applications in organic synthesis. Ethyl ester functionality suggests that it may exhibit moderate solubility in organic solvents, making it suitable for various chemical reactions. The compound's structure may allow for interactions with biological systems, indicating potential pharmacological or biochemical relevance. Overall, its unique structural features and functional groups make it a subject of interest in synthetic organic chemistry and potentially in medicinal chemistry as well.

Formula: C₁₁H₁₄N₂O₄

InChI: InChI=1S/C11H14N2O4/c1-2-17-8(14)6-5-3-4-11(7(5)6)9(15)12-10(16)13-11/h5-7H,2-4H2,1H3,(H2,12,13,15,16)

InChI key: InChIKey=DOMXPWHMRGUFMM-UHFFFAOYSA-N

SMILES: O=C1C2(C3C(C3C(OCC)=O)CC2)NC(=O)N1

Synonyms:

• Spiro[bicyclo[3.1.0]hexane-2,4′-imidazolidine]-6-carboxylic acid, 2′,5′-dioxo-, ethyl ester
• Ethyl 2′,5′-dioxospiro[bicyclo[3.1.0]hexane-2,4′-imidazolidine]-6-carboxylate