CAS 176219-12-8

2-[[(4-Hydroxy-3,5-dimethyl-2-pyridinyl)methyl]thio]-1H-benzimidazol-6-ol

Description:

2-[[(4-Hydroxy-3,5-dimethyl-2-pyridinyl)methyl]thio]-1H-benzimidazol-6-ol, with the CAS number 176219-12-8, is a chemical compound characterized by its complex structure, which includes a benzimidazole core and a pyridine moiety. This compound features a thioether linkage, connecting the pyridine ring to the benzimidazole, and possesses a hydroxyl group that contributes to its potential biological activity. The presence of the dimethyl groups on the pyridine ring enhances its lipophilicity, which may influence its pharmacokinetic properties. The compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, making it a subject of interest for further research in various fields, including pharmacology and biochemistry.

Formula: C₁₅H₁₅N₃O₂S

InChI: InChI=1S/C15H15N3O2S/c1-8-6-16-13(9(2)14(8)20)7-21-15-17-11-4-3-10(19)5-12(11)18-15/h3-6,19H,7H2,1-2H3,(H,16,20)(H,17,18)

InChI key: InChIKey=DFTLOBPKLZDKCN-UHFFFAOYSA-N

SMILES: S(CC1=C(C)C(O)=C(C)C=N1)C=2NC=3C(N2)=CC(O)=CC3

Synonyms:

• 1H-Benzimidazol-6-ol, 2-[[(4-hydroxy-3,5-dimethyl-2-pyridinyl)methyl]thio]-
• 1H-Benzimidazol-5-ol, 2-[[(4-hydroxy-3,5-dimethyl-2-pyridinyl)methyl]thio]-
• 2-[[(4-Hydroxy-3,5-dimethyl-2-pyridinyl)methyl]thio]-1H-benzimidazol-6-ol

O,O-Didesmethyl Omeprazole Sulfide

CAS: 176219-12-8

Formula: C₁₅H₁₅N₃O₂S

Color and Shape: Off-White Solid

Molecular weight: 301.37

Ref: 4Z-O-0222

4,5'-Di(desmethyl) Omeprazole Sulfide

Controlled Product

CAS: 176219-12-8

Formula: C₁₅H₁₅N₃O₂S

Color and Shape: Neat

Molecular weight: 301.363

Ref: TR-D441670