CymitQuimica logo

CAS 176244-21-6

:

2H-Benzimidazol-2-one,5,6-difluoro-1,3-dihydro-(9CI)

Description:
2H-Benzimidazol-2-one, 5,6-difluoro-1,3-dihydro- (CAS 176244-21-6) is a chemical compound characterized by its benzimidazole core structure, which consists of a fused benzene and imidazole ring. The presence of two fluorine atoms at the 5 and 6 positions of the benzimidazole ring significantly influences its chemical properties, including increased lipophilicity and potential biological activity. This compound typically exhibits a solid-state at room temperature and may have moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The difluorinated benzimidazole derivatives are often studied for their antimicrobial, antifungal, or anticancer properties. Additionally, the compound's stability and reactivity can be influenced by the electron-withdrawing nature of the fluorine substituents, which can affect its interaction with biological targets. Overall, 2H-Benzimidazol-2-one, 5,6-difluoro-1,3-dihydro- is of interest in medicinal chemistry and material science due to its unique structural features and potential applications.
Formula:C7H4F2N2O
InChI:InChI=1S/C7H4F2N2O/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12)
InChI key:FNIZLMLIRWCFRX-UHFFFAOYSA-N
SMILES:C1=C2C(=CC(=C1F)F)NC(=O)N2
Found 4 products.