
CAS 17627-10-0
:N,N′-Bis(1-oxohexadecyl)-L-cystine
Description:
N,N′-Bis(1-oxohexadecyl)-L-cystine is a synthetic compound characterized by its unique structure, which includes two hexadecyl chains attached to the cystine backbone. This compound features a cystine moiety, which is a dimer of cysteine linked by a disulfide bond, and is modified with long-chain fatty acid derivatives. The presence of the hexadecyl groups imparts hydrophobic characteristics, making it amphiphilic, which can influence its solubility and interaction with biological membranes. N,N′-Bis(1-oxohexadecyl)-L-cystine may exhibit surfactant properties, potentially useful in drug delivery systems or as an emulsifying agent. Its molecular structure suggests potential applications in biochemistry and materials science, particularly in the development of lipid-based formulations. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications. Overall, this compound represents a fascinating intersection of organic chemistry and biochemistry, with implications for various fields including pharmaceuticals and biotechnology.
Formula:C38H72N2O6S2
InChI:InChI=1S/C38H72N2O6S2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-35(41)39-33(37(43)44)31-47-48-32-34(38(45)46)40-36(42)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h33-34H,3-32H2,1-2H3,(H,39,41)(H,40,42)(H,43,44)(H,45,46)/t33-,34-/m0/s1
InChI key:InChIKey=JIUGOZSZLYKDDH-HEVIKAOCSA-N
SMILES:[C@@H](CSSC[C@H](NC(CCCCCCCCCCCCCCC)=O)C(O)=O)(NC(CCCCCCCCCCCCCCC)=O)C(O)=O
Synonyms:- L-Cystine, N,N′-bis(1-oxohexadecyl)-
- N,N′-Dipalmitoyl-L-cystine
- Cystine, N,N′-dipalmitoyl-, L-
- N,N′-Bis(1-oxohexadecyl)-L-cystine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dipalmitoyl cystine
CAS:Dipalmitoyl cystine is a bioactive chemical.Formula:C38H72N2O6S2Color and Shape:SolidMolecular weight:717.12
