CAS 176299-96-0
:(4aS,6S,7S,8R,8aR)-6-(4-methoxyphenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol
Description:
The chemical substance with the name "(4aS,6S,7S,8R,8aR)-6-(4-methoxyphenoxy)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol" and CAS number "176299-96-0" is a complex organic compound characterized by its multi-ring structure, which includes a hexahydropyrano dioxine framework. This compound features multiple stereocenters, contributing to its specific three-dimensional configuration and potentially influencing its biological activity. The presence of a methoxyphenoxy group suggests that it may exhibit interesting interactions with biological targets, possibly enhancing its solubility and reactivity. The hydroxyl groups in the structure indicate that it may participate in hydrogen bonding, which can affect its physical properties such as melting point and solubility in various solvents. Additionally, the compound's intricate structure may confer unique pharmacological properties, making it a candidate for further research in medicinal chemistry. Overall, this substance exemplifies the complexity and diversity of organic compounds in the realm of chemical research.
Formula:C20H22O7
InChI:InChI=1/C20H22O7/c1-23-13-7-9-14(10-8-13)25-20-17(22)16(21)18-15(26-20)11-24-19(27-18)12-5-3-2-4-6-12/h2-10,15-22H,11H2,1H3/t15-,16+,17-,18-,19?,20+/m0/s1
Synonyms:- 4-Methoxyphenyl 4,6-O-benzylidene-α-L-allopyranoside
- α-L-allopyranoside, 4-methoxyphenyl 4,6-O-(phenylmethylene)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methoxyphenyl 4,6-O-Benzylidene-β-D-galactopyranoside
CAS:Formula:C20H22O7Color and Shape:SolidMolecular weight:374.39β-D-Galactopyranoside, 4-methoxyphenyl 4,6-O-[(S)-phenylmethylene]-
CAS:Formula:C20H22O7Molecular weight:374.38454-Methoxyphenyl 4,6-O-benzylidene-β-D-galactopyranoside
CAS:4-Methoxyphenyl 4,6-O-benzylidene-β-D-galactopyranosidePurity:98%Molecular weight:374.38g/mol4-Methoxyphenyl 4,6-O-Benzylidene-b-D-galactopyranoside
CAS:4-Methoxyphenyl 4,6-O-Benzylidene-b-D-galactopyranoside is a diagnostic agent that reacts with the magnesium salt of 4,6-O-benzylidene b-D-galactopyranoside to form a bright red complex. The reaction of the complex with the magnesium oxide is rapid and highly specific for this substrate. The intensity of color can be measured spectrophotometrically at a wavelength of 420 nm. This product may be used in medical research to diagnose Alzheimer's Disease or other neurological disorders that are characterized by impaired cognition and memory.Formula:C20H22O7Purity:Min. 95%Molecular weight:374.38 g/mol





