CAS 17635-44-8
:3,4,5-Tribromopyrazole
Description:
3,4,5-Tribromopyrazole is a halogenated organic compound characterized by the presence of three bromine atoms attached to a pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound typically exhibits a high degree of stability due to the aromatic nature of the pyrazole structure. The bromine substituents enhance its reactivity, making it useful in various chemical applications, including as a building block in the synthesis of more complex molecules. 3,4,5-Tribromopyrazole is often studied for its potential biological activities, including antifungal and herbicidal properties. Its physical properties, such as solubility and melting point, can vary depending on the specific conditions and purity of the sample. Additionally, the presence of bromine atoms can influence its environmental persistence and toxicity, necessitating careful handling and disposal in laboratory settings. Overall, 3,4,5-Tribromopyrazole serves as an important compound in both synthetic organic chemistry and agricultural chemistry.
Formula:C3HBr3N2
InChI:InChI=1/C3HBr3N2/c4-1-2(5)7-8-3(1)6/h(H,7,8)
SMILES:c1(c(Br)[nH]nc1Br)Br
Synonyms:- 3,4,5-tribromo-1H-pyrazole
- 3,4,5-Tribromo pyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4,5-Tribromopyrazole
CAS:Formula:C3HBr3N2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:304.773,4,5-Tribromo-1H-pyrazole, 97%
CAS:2,4,5-Tribromoimidazole(2,4,5-TBI) on condensation with sugar precursors yields 2,4,5-TBI nucleosides. It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. This Thermo Scientific Chemicals brand product was originally part of the A
Formula:C3HBr3N2Purity:97%Color and Shape:White to pale cream, PowderMolecular weight:304.781H-Pyrazole, 3,4,5-tribromo-
CAS:Formula:C3HBr3N2Purity:95%Color and Shape:SolidMolecular weight:304.76543,4,5-Tribromo-1H-pyrazole
CAS:3,4,5-Tribromo-1H-pyrazoleFormula:C3HBr3N2Purity:98%Color and Shape: off white to faint yellow powderMolecular weight:304.77g/mol3,4,5-Tribromo-1H-pyrazole
CAS:Formula:C3HBr3N2Purity:95%Color and Shape:SolidMolecular weight:304.767




