CAS 17636-16-7

2-hydroxy-4-[(2-hydroxy-4-methoxy-3,6-dimethylbenzoyl)oxy]-3,6-dimethylbenzoic acid

Description:

2-Hydroxy-4-[(2-hydroxy-4-methoxy-3,6-dimethylbenzoyl)oxy]-3,6-dimethylbenzoic acid, with CAS number 17636-16-7, is an organic compound characterized by its complex structure, which includes multiple functional groups such as hydroxyl (-OH) and methoxy (-OCH3) groups. This compound belongs to the class of benzoic acids and is known for its potential applications in pharmaceuticals and as a chemical intermediate. Its molecular structure suggests it may exhibit properties such as antioxidant activity, which is often associated with compounds containing hydroxyl groups. The presence of multiple methyl groups contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Additionally, the compound's ability to form hydrogen bonds due to its hydroxyl groups may enhance its interactions in biological systems. Overall, this compound's unique structural features make it of interest in various chemical and biological research fields.

Formula: C₁₉H₂₀O₇

InChI: InChI=1/C19H20O7/c1-8-7-13(11(4)16(20)14(8)18(22)23)26-19(24)15-9(2)6-12(25-5)10(3)17(15)21/h6-7,20-21H,1-5H3,(H,22,23)

SMILES: Cc1cc(c(C)c(c1C(=O)O)O)OC(=O)c1c(C)cc(c(C)c1O)OC

Benzoic acid, 2-hydroxy-4-[(2-hydroxy-4-methoxy-3,6-dimethylbenzoyl)oxy]-3,6-dimethyl-

CAS: 17636-16-7

Formula: C₁₉H₂₀O₇

Molecular weight: 360.3579

Ref: IN-DA0024LG

Barbatic Acid

Controlled Product

CAS: 17636-16-7

Formula: C₁₉H₂₀O₇

Color and Shape: Neat

Molecular weight: 360.358

Ref: TR-B120080

Barbatic acid

CAS: 17636-16-7

Barbatic acid is a natural compound derived from D-xylose that has been shown to have anticancer properties. It works by inhibiting kinases, which are enzymes that play a role in tumor growth and progression. Barbatic acid has been found to induce apoptosis, or programmed cell death, in cancer cells without affecting normal cells. This makes it a promising candidate for cancer treatment. In addition, barbatic acid has been shown to inhibit the proliferation of human and Chinese hamster ovary cells in culture. It is also present in urine and has been isolated from a strain of bacteria. Overall, barbatic acid shows potential as a novel inhibitor of kinases for the treatment of cancer.

Formula: C₁₉H₂₀O₇

Purity: Min. 95%

Molecular weight: 360.4 g/mol

Ref: 3D-SAA63616