CAS 176380-53-3
:Fmoc-L-threoninol
Description:
Fmoc-L-threoninol, with the CAS number 176380-53-3, is a chemical compound that serves as a derivative of the amino acid threonine. It features a 9-fluorenylmethoxycarbonyl (Fmoc) protective group, which is commonly used in peptide synthesis to protect the amino group during the formation of peptide bonds. This compound is characterized by its ability to participate in various chemical reactions, particularly in the context of solid-phase peptide synthesis. Fmoc-L-threoninol is typically a white to off-white solid and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and methanol, but less soluble in water. Its structure includes a hydroxyl group, which contributes to its reactivity and potential applications in medicinal chemistry and biochemistry. The presence of the Fmoc group allows for selective deprotection under mild conditions, facilitating the synthesis of peptides and other complex molecules. Overall, Fmoc-L-threoninol is a valuable building block in the field of organic and medicinal chemistry.
Formula:C19H21NO4
InChI:InChI=1/C19H21NO4/c1-12(22)18(10-21)20-19(23)24-11-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,12,17-18,21-22H,10-11H2,1H3,(H,20,23)/t12-,18-/m1/s1
SMILES:C[C@H]([C@@H](CO)N=C(O)OCC1c2ccccc2c2ccccc12)O
Synonyms:- 9H-fluoren-9-ylmethyl [(1R,2R)-2-hydroxy-1-(hydroxymethyl)propyl]carbamate
- Fmoc-Thr-ol
- N-Fmoc-L-threonol
- Fmoc-Threoninol
- Fmoc-D-(4-NO2)-Phe
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Fmoc-L-threoninol
CAS:Bachem ID: 4026268.
Formula:C19H21NO4Purity:99.71%Color and Shape:White PowderMolecular weight:327.38Carbamic acid, N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)propyl]-, 9H-fluoren-9-ylmethyl ester
CAS:Formula:C19H21NO4Purity:97%Color and Shape:SolidMolecular weight:327.3743Fmoc-Threoninol
CAS:M03458 - Fmoc-Threoninol
Formula:C19H21NO4Purity:95%Color and Shape:Solid, No data available.Molecular weight:327.3800048828125Fmoc-L-threoninol
CAS:Fmoc-L-threoninol is a conjugate of L-threoninol with a protecting group, Fmoc. It is synthesized by the solid-phase method on an activated resin and then cleaved from the resin to give the desired product. The linker used in this synthesis is succinic acid diacetate. This compound has been shown to have anti-inflammatory effects in human serum, which may be due to its ability to inhibit prostaglandin synthesis.Formula:C19H21NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:327.37 g/mol





