CAS 17639-39-3
:4-nitrophenyl glycinate
Description:
4-Nitrophenyl glycinate is an organic compound characterized by its structure, which includes a nitrophenyl group and a glycinate moiety. It is typically a white to pale yellow crystalline solid that is soluble in polar solvents such as water and alcohols. The presence of the nitro group (-NO2) on the phenyl ring contributes to its electrophilic properties, making it reactive in various chemical reactions, including nucleophilic substitutions. This compound is often used in biochemical applications, particularly in enzyme assays and as a substrate for studying enzyme kinetics due to its ability to undergo hydrolysis. Additionally, 4-nitrophenyl glycinate can serve as a model compound in the study of amino acid derivatives and their interactions. Safety precautions should be observed when handling this compound, as nitro compounds can be hazardous. Overall, 4-nitrophenyl glycinate is a valuable compound in both synthetic and analytical chemistry contexts.
Formula:C8H8N2O4
InChI:InChI=1/C8H8N2O4/c9-5-8(11)14-7-3-1-6(2-4-7)10(12)13/h1-4H,5,9H2
SMILES:c1cc(ccc1N(=O)=O)OC(=O)CN
Synonyms:- p-Nitrophenyl glycine ester
- Glycine, 4-nitrophenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
