CymitQuimica logo

CAS 17641-09-7

:

2-Iodo-N-(3-methoxyphenyl)acetamide

Description:
2-Iodo-N-(3-methoxyphenyl)acetamide is an organic compound characterized by its iodo substituent and an acetamide functional group. It features a methoxyphenyl group, which contributes to its aromatic properties and potential reactivity. The presence of the iodine atom enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic structure. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the methoxy group can influence biological activity and solubility. Additionally, the compound's unique characteristics may allow for further derivatization, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.
Formula:C9H10INO2
InChI:InChI=1S/C9H10INO2/c1-13-8-4-2-3-7(5-8)11-9(12)6-10/h2-5H,6H2,1H3,(H,11,12)
InChI key:InChIKey=YQIDLNFAIBNVOZ-UHFFFAOYSA-N
SMILES:N(C(CI)=O)C1=CC(OC)=CC=C1
Synonyms:
  • m-Acetanisidide, 2-iodo-
  • 2-Iodo-N-(3-methoxyphenyl)acetamide
  • Acetamide, 2-iodo-N-(3-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.