CAS 176433-63-9

6-Chloro-5-formyl-3-pyridinecarbonitrile

Description:

6-Chloro-5-formyl-3-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 6-position and a formyl group at the 5-position contributes to its reactivity and potential applications in organic synthesis. The carbonitrile functional group, located at the 3-position, enhances the compound's polarity and can participate in various chemical reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. As with many nitrogen-containing heterocycles, it may also display interesting biological activities, warranting further investigation in medicinal chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive functional groups.

Formula: C₇H₃ClN₂O

InChI: InChI=1S/C7H3ClN2O/c8-7-6(4-11)1-5(2-9)3-10-7/h1,3-4H

InChI key: InChIKey=CMWSRNXJFMDJNK-UHFFFAOYSA-N

SMILES: C(=O)C=1C=C(C#N)C=NC1Cl

Synonyms:

• 3-Pyridinecarbonitrile, 6-chloro-5-formyl-
• 6-Chloro-5-formyl-3-pyridinecarbonitrile

6-Chloro-5-formylpyridine-3-carbonitrile

CAS: 176433-63-9

Versatile small molecule scaffold

Formula: C₇H₃ClN₂O

Purity: Min. 95%

Molecular weight: 166.56 g/mol

Ref: 3D-BHA43363