CAS 176445-80-0
:4-(Aminomethyl)-N,N-dimethyltetrahydro-2H-pyran-4-amine
Description:
4-(Aminomethyl)-N,N-dimethyltetrahydro-2H-pyran-4-amine, with the CAS number 176445-80-0, is a chemical compound characterized by its unique structure, which includes a tetrahydropyran ring and amine functional groups. This compound features a dimethylamino group and an aminomethyl substituent, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of amine groups suggests that it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, the compound may have implications in pharmaceutical applications, particularly in the development of drugs targeting neurological or metabolic pathways. Safety data should be consulted for handling and storage, as amines can be reactive and may pose health risks if not managed properly. Overall, this compound represents a significant interest in both research and industrial applications.
Formula:C8H18N2O
InChI:InChI=1/C8H18N2O/c1-10(2)8(7-9)3-5-11-6-4-8/h3-7,9H2,1-2H3
SMILES:CN(C)C1(CCOCC1)CN
Synonyms:- 4-(Aminomethyl)-4-(dimethylamino)tetrahydro-2H-pyran
- 4-(Aminomethyl)-4-(dimethylamino)tetrahydro-2H-pyran 95%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Aminomethyl)-N,N-dimethyltetrahydro-2H-pyran-4-amine
CAS:Formula:C8H18N2OPurity:95%Molecular weight:158.24134-(Aminomethyl)-4-(dimethylamino)tetrahydro-2H-pyran
CAS:4-(Aminomethyl)-4-(dimethylamino)tetrahydro-2H-pyranFormula:C8H18N2OPurity:95%Color and Shape: colourless liquidMolecular weight:158.24g/mol(4-Aminomethyl-tetrahydro-pyran-4-yl)-dimethyl-amine
CAS:Formula:C8H18N2OPurity:95.0%Color and Shape:LiquidMolecular weight:158.245[4-(Aminomethyl)tetrahydro-2H-pyran-4-yl]dimethylamine
CAS:4-(Aminomethyl)tetrahydro-2H-pyran-4-yl]dimethylamine is a versatile building block that can be used as a reagent, speciality chemical, or useful scaffold. It is useful in the synthesis of complex compounds and research chemicals. This compound is soluble in water and has a high quality. CAS number: 176445-80-0
Formula:C8H18N2OPurity:Min. 93 Area-%Color and Shape:Clear LiquidMolecular weight:158.24 g/molRef: 3D-FA122699
Discontinued product



