CymitQuimica logo

CAS 1765-10-2

:

2,2,2-Trifluoro-N-(5-nitro-2-pyridinyl)acetamide

Description:
2,2,2-Trifluoro-N-(5-nitro-2-pyridinyl)acetamide is a chemical compound characterized by its unique structure, which includes a trifluoroacetamide group and a nitropyridine moiety. This compound typically appears as a solid at room temperature and is known for its polar nature due to the presence of both the trifluoromethyl and nitro groups, which can influence its solubility in various solvents. The trifluoromethyl group imparts significant electronegativity, enhancing the compound's reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The nitro group can serve as a site for further chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which can be explored in various research contexts. Safety data sheets should be consulted for handling and storage guidelines, as compounds containing nitro groups can pose specific hazards. Overall, 2,2,2-Trifluoro-N-(5-nitro-2-pyridinyl)acetamide is a noteworthy compound in the field of organic and medicinal chemistry.
Formula:C7H4F3N3O3
InChI:InChI=1S/C7H4F3N3O3/c8-7(9,10)6(14)12-5-2-1-4(3-11-5)13(15)16/h1-3H,(H,11,12,14)
InChI key:InChIKey=MVLRICCEEDVTRN-UHFFFAOYSA-N
SMILES:N(C(C(F)(F)F)=O)C1=CC=C(N(=O)=O)C=N1
Synonyms:
  • Acetamide, 2,2,2-trifluoro-N-(5-nitro-2-pyridinyl)-
  • 2,2,2-Trifluoro-N-(5-nitro-2-pyridinyl)acetamide
  • Pyridine, 5-nitro-2-(2,2,2-trifluoroacetamido)-
Found 0 products.