CymitQuimica logo

CAS 1765-92-0

:

3-Heptafluoropropyl-1,2-epoxypropane

Description:
3-Heptafluoropropyl-1,2-epoxypropane, with the CAS number 1765-92-0, is a fluorinated organic compound characterized by its unique structure that includes both epoxy and perfluorinated groups. This compound typically exhibits high thermal stability and low surface tension due to the presence of fluorine atoms, which can enhance its chemical resistance and hydrophobic properties. The epoxy group in its structure provides reactive sites that can participate in various chemical reactions, making it useful in polymer chemistry and as a potential building block for more complex fluorinated materials. Additionally, the presence of fluorine atoms often imparts unique properties such as low volatility and high dielectric strength, which can be advantageous in applications such as coatings, adhesives, and specialty solvents. However, the environmental impact and regulatory considerations associated with fluorinated compounds should also be taken into account, as they may pose challenges related to persistence and bioaccumulation. Overall, 3-Heptafluoropropyl-1,2-epoxypropane is a compound of interest in both industrial and research settings due to its distinctive chemical properties.
Formula:C6H5F7O
InChI:InChI=1/C6H5F7O/c7-4(8,1-3-2-14-3)5(9,10)6(11,12)13/h3H,1-2H2
InChI key:YXNWXQYDINSHJC-UHFFFAOYSA-N
SMILES:C(C1CO1)C(C(C(F)(F)F)(F)F)(F)F
Synonyms:
  • (2,2,3,3,4,4,4-Heptafluorobutyl)oxirane
  • 2-(2,2,3,3,4,4,4-Heptafluorobutyl)Oxirane
Found 4 products.