
CAS 176520-24-4
:Ethanol, 2-[2-(2-azidoethoxy)ethoxy]-, 1-methanesulfonate
Description:
Ethanol, 2-[2-(2-azidoethoxy)ethoxy]-, 1-methanesulfonate, identified by CAS number 176520-24-4, is a chemical compound that features a complex structure incorporating an azido group and a methanesulfonate moiety. This compound is characterized by its ether and sulfonate functional groups, which contribute to its solubility in polar solvents and potential reactivity. The presence of the azido group suggests that it may participate in click chemistry reactions, making it useful in synthetic organic chemistry for the formation of diverse compounds. Additionally, the methanesulfonate group can serve as a leaving group in nucleophilic substitution reactions, enhancing its utility in various chemical transformations. Ethanol, as a solvent and a part of the compound's structure, indicates that it may exhibit moderate volatility and is likely to be hygroscopic. Overall, this compound's unique functional groups and structural features make it a valuable candidate for applications in medicinal chemistry, materials science, and bioconjugation strategies.
Formula:C7H15N3O5S
InChI:InChI=1S/C7H15N3O5S/c1-16(11,12)15-7-6-14-5-4-13-3-2-9-10-8/h2-7H2,1H3
InChI key:InChIKey=ZOOKULHFCBIPIO-UHFFFAOYSA-N
SMILES:C(OCCOCCN=[N+]=[N-])COS(C)(=O)=O
Synonyms:- Ethanol, 2-[2-(2-azidoethoxy)ethoxy]-, methanesulfonate (ester)
- 2-(2-(2-Azidoethoxy)ethoxy)ethyl methanesulfonate
- Ethanol, 2-[2-(2-azidoethoxy)ethoxy]-, 1-methanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Azido-PEG3-MS
CAS:Azido-PEG3-MS is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C7H15N3O5SColor and Shape:SolidMolecular weight:253.27
