CAS 176530-47-5

4-CHLORO-2-(METHYLSULFANYL)THIENO[3,2-D]PYRIMIDINE

Description:

4-Chloro-2-(methylsulfanyl)thieno[3,2-d]pyrimidine is a heterocyclic compound characterized by its unique structural features, which include a thieno[3,2-d]pyrimidine core with a chlorine atom and a methylsulfanyl group. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the chlorine atom can influence its reactivity and solubility, while the methylsulfanyl group may enhance its lipophilicity and biological interactions. The compound's molecular structure allows for various substitution patterns, which can affect its pharmacological properties. Additionally, it may exhibit properties such as moderate stability under standard conditions, but specific reactivity can depend on the surrounding environment and functional groups present. Overall, 4-chloro-2-(methylsulfanyl)thieno[3,2-d]pyrimidine represents a class of compounds with significant interest in chemical and pharmaceutical research.

Formula: C₇H₅ClN₂S₂

InChI: InChI=1/C7H5ClN2S2/c1-11-7-9-4-2-3-12-5(4)6(8)10-7/h2-3H,1H3

SMILES: CSc1nc2ccsc2c(Cl)n1

Synonyms:

• 4-Chlorothieno[3,2-D]Pyrimidin-2-Yl Methyl Sulfide
• 4-Chloro-2-(Methylthio)Thieno[3,2-D]Pyrimidine

Thieno[3,2-d]pyrimidine, 4-chloro-2-(methylthio)-

CAS: 176530-47-5

Formula: C₇H₅ClN₂S₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 216.711

Ref: IN-DA0024R0

4-Chloro-2-(methylthio)thieno[3,2-d]pyrimidine

CAS: 176530-47-5

Purity: 95.0%

Molecular weight: 216.6999969482422

Ref: 10-F321173