CAS 17658-63-8
:2-Hexadecyl-1-eicosanol
Description:
2-Hexadecyl-1-eicosanol, with the CAS number 17658-63-8, is a long-chain alcohol characterized by its hydrophobic nature due to the lengthy hydrocarbon chains. This compound features a hexadecyl group (a 16-carbon alkyl chain) attached to the second carbon of a 20-carbon eicosanol backbone. As a fatty alcohol, it exhibits properties typical of long-chain alcohols, including low solubility in water and higher solubility in organic solvents. Its structure contributes to its potential applications in various fields, such as cosmetics, where it may serve as an emollient or thickening agent. Additionally, due to its long carbon chain, it may exhibit surfactant properties, making it useful in formulations requiring emulsification. The compound's melting and boiling points are influenced by its molecular weight and structure, typically resulting in solid-state at room temperature. Overall, 2-Hexadecyl-1-eicosanol is notable for its role in enhancing the texture and stability of products while providing moisturizing benefits.
Formula:C36H74O
InChI:InChI=1S/C36H74O/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36(35-37)33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h36-37H,3-35H2,1-2H3
InChI key:InChIKey=JQJGGMZIMBGQQY-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCCC)(CCCCCCCCCCCCCCCC)CO
Synonyms:- 1-Eicosanol, 2-hexadecyl-
- 2-Hexadecyl-1-eicosanol
- 2-Hexadecylarachic alcohol
- 2-Hexadecyleicosanol
- 2-Hexadecylicosan-1-Ol
- Guerbet C36
- Isofol 36
- 2-Hexadecylicosanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Hexadecyl-1-eicosanol
CAS:Controlled ProductFormula:C36H74OColor and Shape:NeatMolecular weight:522.972
