CAS 1766-41-2

perfluorotetracosane

Description:

Perfluorotetracosane is a synthetic perfluorinated compound characterized by a long carbon chain consisting of 24 carbon atoms, where all hydrogen atoms are replaced by fluorine atoms. This results in a fully fluorinated alkane, contributing to its unique properties. Perfluorotetracosane is typically colorless, odorless, and hydrophobic, exhibiting low surface tension and high thermal stability. Its chemical structure imparts exceptional resistance to chemical reactions, making it non-reactive under a wide range of conditions. Additionally, it has a high boiling point and low volatility, which can be advantageous in various industrial applications, including as a lubricant or in coatings. However, like other perfluorinated compounds, it raises environmental and health concerns due to its persistence in the environment and potential bioaccumulation. Regulatory scrutiny has increased regarding the use of such substances, prompting research into their ecological impact and alternatives. Overall, perfluorotetracosane exemplifies the unique characteristics of perfluorinated compounds, combining stability with environmental considerations.

Formula: C₂₄F₅₀

InChI: InChI=1/C24F50/c25-1(26,3(29,30)5(33,34)7(37,38)9(41,42)11(45,46)13(49,50)15(53,54)17(57,58)19(61,62)21(65,66)23(69,70)71)2(27,28)4(31,32)6(35,36)8(39,40)10(43,44)12(47,48)14(51,52)16(55,56)18(59,60)20(63,64)22(67,68)24(72,73)74

SMILES: C(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Synonyms:

• Pentacontafluorotetracosane

Tetracosane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,22,22,23,23,24,24,24-pentacontafluoro-

CAS: 1766-41-2

Formula: C₂₄F₅₀

Molecular weight: 1238.177

Ref: IN-DA0024RX

Pentacontafluorotetracosane

Controlled Product

CAS: 1766-41-2

Pentacontafluorotetracosane is a perfluorinated compound that has been shown to have antimicrobial properties. It is also stable in the presence of oxygen and moisture, which makes it an effective disinfectant for medical devices. Pentacontafluorotetracosane is used as a monomer in the production of other fluorine-containing compounds. It can be used as an additive to prevent the evaporation of solvents, such as trifluoroacetic acid, or to modify the surface properties of metals. Pentacontafluorotetracosane has a carbonyl group that can be oxidized by radiation, which leads to its chemical instability.

Formula: C₂₄F₅₀

Purity: Min. 95%

Molecular weight: 1,238.18 g/mol

Ref: 3D-FP78457

Perfluorotetracosane

CAS: 1766-41-2

Formula: C₂₄F₅₀

Molecular weight: 1238.18

Ref: 4Z-P-398049